C13H6ClF5N2 — CID 12730131
(1Z)-2,3,4,5,6-pentafluoro-N-phenylbenzenecarbohydrazonoyl chloride (PubChem CID 12730131) has the molecular formula C13H6ClF5N2 and a molecular weight of 320.65 g/mol. Its IUPAC name is (1Z)-2,3,4,5,6-pentafluoro-N-phenylbenzenecarbohydrazonoyl chloride.
| Compound Name | (1Z)-2,3,4,5,6-pentafluoro-N-phenylbenzenecarbohydrazonoyl chloride |
|---|---|
| PubChem CID | 12730131 |
| Molecular Formula | C13H6ClF5N2 |
| Molecular Weight | 320.65 g/mol |
| Exact Mass | 320.01 |
| IUPAC Name | (1Z)-2,3,4,5,6-pentafluoro-N-phenylbenzenecarbohydrazonoyl chloride |
| SMILES | Fc1c(F)c(F)c(/C(Cl)=N/Nc2ccccc2)c(F)c1F |
| InChI | InChI=1S/C13H6ClF5N2/c14-13(21-20-6-4-2-1-3-5-6)7-8(15)10(17)12(19)11(18)9(7)16/h1-5,20H/b21-13- |
| InChIKey | WITUJHXPONLPNG-BKUYFWCQSA-N |
| XLogP | 4.39 |
| TPSA | 24.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.65 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|