About 5,5-dimethyl-1,3,2-dioxaphosphinane
5,5-dimethyl-1,3,2-dioxaphosphinane (PubChem CID 12730249) has the molecular formula C5H11O2P
and a molecular weight of 134.12 g/mol. Its IUPAC name is 5,5-dimethyl-1,3,2-dioxaphosphinane.
Molecular Properties
| Compound Name | 5,5-dimethyl-1,3,2-dioxaphosphinane |
| PubChem CID | 12730249 |
| Molecular Formula | C5H11O2P |
| Molecular Weight | 134.12 g/mol |
| Exact Mass | 134.05 |
| IUPAC Name | 5,5-dimethyl-1,3,2-dioxaphosphinane |
| SMILES | CC1(C)COPOC1 |
| InChI | InChI=1S/C5H11O2P/c1-5(2)3-6-8-7-4-5/h8H,3-4H2,1-2H3 |
| InChIKey | MTANQWXSMWFCNJ-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.12 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dimethyl-1,3,2-dioxaphosphinane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethyl-1,3,2-dioxaphosphinane?
The IUPAC name of 5,5-dimethyl-1,3,2-dioxaphosphinane (CID 12730249) is 5,5-dimethyl-1,3,2-dioxaphosphinane.
What is the SMILES notation for 5,5-dimethyl-1,3,2-dioxaphosphinane?
The canonical SMILES for 5,5-dimethyl-1,3,2-dioxaphosphinane is CC1(C)COPOC1.
What is the InChIKey of 5,5-dimethyl-1,3,2-dioxaphosphinane?
The InChIKey is MTANQWXSMWFCNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11O2P/c1-5(2)3-6-8-7-4-5/h8H,3-4H2,1-2H3.
What are the key properties of 5,5-dimethyl-1,3,2-dioxaphosphinane?
5,5-dimethyl-1,3,2-dioxaphosphinane has a molecular weight of 134.12 g/mol, XLogP of 1.57, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethyl-1,3,2-dioxaphosphinane is sourced from PubChem (CID 12730249), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).