C9H22N3P — CID 12730253
N,N-diethyl-1,3-dimethyl-1,3,2-diazaphosphinan-2-amine (PubChem CID 12730253) has the molecular formula C9H22N3P and a molecular weight of 203.27 g/mol. Its IUPAC name is N,N-diethyl-1,3-dimethyl-1,3,2-diazaphosphinan-2-amine.
| Compound Name | N,N-diethyl-1,3-dimethyl-1,3,2-diazaphosphinan-2-amine |
|---|---|
| PubChem CID | 12730253 |
| Molecular Formula | C9H22N3P |
| Molecular Weight | 203.27 g/mol |
| Exact Mass | 203.16 |
| IUPAC Name | N,N-diethyl-1,3-dimethyl-1,3,2-diazaphosphinan-2-amine |
| SMILES | CCN(CC)P1N(C)CCCN1C |
| InChI | InChI=1S/C9H22N3P/c1-5-12(6-2)13-10(3)8-7-9-11(13)4/h5-9H2,1-4H3 |
| InChIKey | AJQCLZMYIBWMBX-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 9.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.27 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|