About bis(1-ethylcyclopenta-1,3-diene);ruthenium
bis(1-ethylcyclopenta-1,3-diene);ruthenium (PubChem CID 12730332) has the molecular formula C14H20Ru
and a molecular weight of 289.38 g/mol. Its IUPAC name is bis(1-ethylcyclopenta-1,3-diene);ruthenium.
Molecular Properties
| Compound Name | bis(1-ethylcyclopenta-1,3-diene);ruthenium |
| PubChem CID | 12730332 |
| Molecular Formula | C14H20Ru |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | bis(1-ethylcyclopenta-1,3-diene);ruthenium |
| SMILES | CCC1=CC=CC1.CCC1=CC=CC1.[Ru] |
| InChI | InChI=1S/2C7H10.Ru/c2*1-2-7-5-3-4-6-7;/h2*3-5H,2,6H2,1H3; |
| InChIKey | URJDFFZSHHUWMY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze bis(1-ethylcyclopenta-1,3-diene);ruthenium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(1-ethylcyclopenta-1,3-diene);ruthenium?
The IUPAC name of bis(1-ethylcyclopenta-1,3-diene);ruthenium (CID 12730332) is bis(1-ethylcyclopenta-1,3-diene);ruthenium.
What is the SMILES notation for bis(1-ethylcyclopenta-1,3-diene);ruthenium?
The canonical SMILES for bis(1-ethylcyclopenta-1,3-diene);ruthenium is CCC1=CC=CC1.CCC1=CC=CC1.[Ru].
What is the InChIKey of bis(1-ethylcyclopenta-1,3-diene);ruthenium?
The InChIKey is URJDFFZSHHUWMY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H10.Ru/c2*1-2-7-5-3-4-6-7;/h2*3-5H,2,6H2,1H3;.
What are the key properties of bis(1-ethylcyclopenta-1,3-diene);ruthenium?
bis(1-ethylcyclopenta-1,3-diene);ruthenium has a molecular weight of 289.38 g/mol, XLogP of 4.56, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for bis(1-ethylcyclopenta-1,3-diene);ruthenium is sourced from PubChem (CID 12730332), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).