C23H27O5P — CID 12730348
5-methoxy-2,2,3,3-tetramethyl-7,10-diphenyl-1,4,6,11-tetraoxa-5lambda5-phosphaspiro[4.6]undeca-7,9-diene (PubChem CID 12730348) has the molecular formula C23H27O5P and a molecular weight of 414.44 g/mol. Its IUPAC name is 5-methoxy-2,2,3,3-tetramethyl-7,10-diphenyl-1,4,6,11-tetraoxa-5lambda5-phosphaspiro[4.6]undeca-7,9-diene.
| Compound Name | 5-methoxy-2,2,3,3-tetramethyl-7,10-diphenyl-1,4,6,11-tetraoxa-5lambda5-phosphaspiro[4.6]undeca-7,9-diene |
|---|---|
| PubChem CID | 12730348 |
| Molecular Formula | C23H27O5P |
| Molecular Weight | 414.44 g/mol |
| Exact Mass | 414.16 |
| IUPAC Name | 5-methoxy-2,2,3,3-tetramethyl-7,10-diphenyl-1,4,6,11-tetraoxa-5lambda5-phosphaspiro[4.6]undeca-7,9-diene |
| SMILES | COP12(OC(c3ccccc3)=CC=C(c3ccccc3)O1)OC(C)(C)C(C)(C)O2 |
| InChI | InChI=1S/C23H27O5P/c1-22(2)23(3,4)28-29(24-5,27-22)25-20(18-12-8-6-9-13-18)16-17-21(26-29)19-14-10-7-11-15-19/h6-17H,1-5H3 |
| InChIKey | IJSIALATJAYPNJ-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.44 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|