C25H32Si — CID 12730932
4,4-diphenylbuta-1,2,3-trienyl-methyl-bis(2-methylpropyl)silane (PubChem CID 12730932) has the molecular formula C25H32Si and a molecular weight of 360.62 g/mol. Its IUPAC name is 4,4-diphenylbuta-1,2,3-trienyl-methyl-bis(2-methylpropyl)silane.
| Compound Name | 4,4-diphenylbuta-1,2,3-trienyl-methyl-bis(2-methylpropyl)silane |
|---|---|
| PubChem CID | 12730932 |
| Molecular Formula | C25H32Si |
| Molecular Weight | 360.62 g/mol |
| Exact Mass | 360.23 |
| IUPAC Name | 4,4-diphenylbuta-1,2,3-trienyl-methyl-bis(2-methylpropyl)silane |
| SMILES | CC(C)C[Si](C)(C=C=C=C(c1ccccc1)c1ccccc1)CC(C)C |
| InChI | InChI=1S/C25H32Si/c1-21(2)19-26(5,20-22(3)4)18-12-17-25(23-13-8-6-9-14-23)24-15-10-7-11-16-24/h6-11,13-16,18,21-22H,19-20H2,1-5H3 |
| InChIKey | AUQXSYUKNFFTKX-UHFFFAOYSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.62 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|