C8H10F9O3P — CID 12731015
1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,4-nonafluorobutane (PubChem CID 12731015) has the molecular formula C8H10F9O3P and a molecular weight of 356.12 g/mol. Its IUPAC name is 1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,4-nonafluorobutane.
| Compound Name | 1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,4-nonafluorobutane |
|---|---|
| PubChem CID | 12731015 |
| Molecular Formula | C8H10F9O3P |
| Molecular Weight | 356.12 g/mol |
| Exact Mass | 356.02 |
| IUPAC Name | 1-diethoxyphosphoryl-1,1,2,2,3,3,4,4,4-nonafluorobutane |
| SMILES | CCOP(=O)(OCC)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C8H10F9O3P/c1-3-19-21(18,20-4-2)8(16,17)6(11,12)5(9,10)7(13,14)15/h3-4H2,1-2H3 |
| InChIKey | SXRQVPQSAODONG-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.12 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|