C3HF8O2P — CID 12731026
2-difluorophosphoryloxy-1,1,1,3,3,3-hexafluoropropane (PubChem CID 12731026) has the molecular formula C3HF8O2P and a molecular weight of 252.00 g/mol. Its IUPAC name is 2-difluorophosphoryloxy-1,1,1,3,3,3-hexafluoropropane.
| Compound Name | 2-difluorophosphoryloxy-1,1,1,3,3,3-hexafluoropropane |
|---|---|
| PubChem CID | 12731026 |
| Molecular Formula | C3HF8O2P |
| Molecular Weight | 252.00 g/mol |
| Exact Mass | 251.96 |
| IUPAC Name | 2-difluorophosphoryloxy-1,1,1,3,3,3-hexafluoropropane |
| SMILES | O=P(F)(F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C3HF8O2P/c4-2(5,6)1(3(7,8)9)13-14(10,11)12/h1H |
| InChIKey | PZHSYFNURBLHEM-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.00 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|