C6H2F13O3P — CID 12731028
1,1,1,3,3,3-hexafluoro-2-[fluoro(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]oxypropane (PubChem CID 12731028) has the molecular formula C6H2F13O3P and a molecular weight of 400.03 g/mol. Its IUPAC name is 1,1,1,3,3,3-hexafluoro-2-[fluoro(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]oxypropane.
| Compound Name | 1,1,1,3,3,3-hexafluoro-2-[fluoro(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]oxypropane |
|---|---|
| PubChem CID | 12731028 |
| Molecular Formula | C6H2F13O3P |
| Molecular Weight | 400.03 g/mol |
| Exact Mass | 399.95 |
| IUPAC Name | 1,1,1,3,3,3-hexafluoro-2-[fluoro(1,1,1,3,3,3-hexafluoropropan-2-yloxy)phosphoryl]oxypropane |
| SMILES | O=P(F)(OC(C(F)(F)F)C(F)(F)F)OC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C6H2F13O3P/c7-3(8,9)1(4(10,11)12)21-23(19,20)22-2(5(13,14)15)6(16,17)18/h1-2H |
| InChIKey | WFLBJGJOAIKCQO-UHFFFAOYSA-N |
| XLogP | 5.08 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.03 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|