About 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one
4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one (PubChem CID 127313792) has the molecular formula C12H15BrN6O
and a molecular weight of 339.20 g/mol. Its IUPAC name is 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one.
Molecular Properties
| Compound Name | 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one |
| PubChem CID | 127313792 |
| Molecular Formula | C12H15BrN6O |
| Molecular Weight | 339.20 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one |
| SMILES | Cn1ncc(N2CCCC(n3cncn3)C2)c(Br)c1=O |
| InChI | InChI=1S/C12H15BrN6O/c1-17-12(20)11(13)10(5-15-17)18-4-2-3-9(6-18)19-8-14-7-16-19/h5,7-9H,2-4,6H2,1H3 |
| InChIKey | RWNHEXONAWBAOG-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 68.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.20 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one?
The IUPAC name of 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one (CID 127313792) is 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one.
What is the SMILES notation for 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one?
The canonical SMILES for 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one is Cn1ncc(N2CCCC(n3cncn3)C2)c(Br)c1=O.
What is the InChIKey of 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one?
The InChIKey is RWNHEXONAWBAOG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15BrN6O/c1-17-12(20)11(13)10(5-15-17)18-4-2-3-9(6-18)19-8-14-7-16-19/h5,7-9H,2-4,6H2,1H3.
What are the key properties of 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one?
4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one has a molecular weight of 339.20 g/mol, XLogP of 0.98, 2 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bromo-2-methyl-5-[3-(1,2,4-triazol-1-yl)piperidin-1-yl]pyridazin-3-one is sourced from PubChem (CID 127313792), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).