About 2-methylideneoctanoic acid
2-methylideneoctanoic acid (PubChem CID 12731439) has the molecular formula C9H16O2
and a molecular weight of 156.22 g/mol. Its IUPAC name is 2-methylideneoctanoic acid.
Molecular Properties
| Compound Name | 2-methylideneoctanoic acid |
| PubChem CID | 12731439 |
| Molecular Formula | C9H16O2 |
| Molecular Weight | 156.22 g/mol |
| Exact Mass | 156.12 |
| IUPAC Name | 2-methylideneoctanoic acid |
| SMILES | C=C(CCCCCC)C(=O)O |
| InChI | InChI=1S/C9H16O2/c1-3-4-5-6-7-8(2)9(10)11/h2-7H2,1H3,(H,10,11) |
| InChIKey | DJDGWVCBUNYBOO-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.22 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 2-methylideneoctanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylideneoctanoic acid?
The IUPAC name of 2-methylideneoctanoic acid (CID 12731439) is 2-methylideneoctanoic acid.
What is the SMILES notation for 2-methylideneoctanoic acid?
The canonical SMILES for 2-methylideneoctanoic acid is C=C(CCCCCC)C(=O)O.
What is the InChIKey of 2-methylideneoctanoic acid?
The InChIKey is DJDGWVCBUNYBOO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16O2/c1-3-4-5-6-7-8(2)9(10)11/h2-7H2,1H3,(H,10,11).
What are the key properties of 2-methylideneoctanoic acid?
2-methylideneoctanoic acid has a molecular weight of 156.22 g/mol, XLogP of 2.60, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylideneoctanoic acid is sourced from PubChem (CID 12731439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).