C15H34Si3 — CID 12732192
trimethyl-(1,1,3,4-tetramethyl-6-trimethylsilyl-2,5-dihydrosilin-6-yl)silane (PubChem CID 12732192) has the molecular formula C15H34Si3 and a molecular weight of 298.70 g/mol. Its IUPAC name is trimethyl-(1,1,3,4-tetramethyl-6-trimethylsilyl-2,5-dihydrosilin-6-yl)silane.
| Compound Name | trimethyl-(1,1,3,4-tetramethyl-6-trimethylsilyl-2,5-dihydrosilin-6-yl)silane |
|---|---|
| PubChem CID | 12732192 |
| Molecular Formula | C15H34Si3 |
| Molecular Weight | 298.70 g/mol |
| Exact Mass | 298.20 |
| IUPAC Name | trimethyl-(1,1,3,4-tetramethyl-6-trimethylsilyl-2,5-dihydrosilin-6-yl)silane |
| SMILES | CC1=C(C)C[Si](C)(C)C([Si](C)(C)C)([Si](C)(C)C)C1 |
| InChI | InChI=1S/C15H34Si3/c1-13-11-15(16(3,4)5,17(6,7)8)18(9,10)12-14(13)2/h11-12H2,1-10H3 |
| InChIKey | XUEAXNKLPOLVIG-UHFFFAOYSA-N |
| XLogP | 5.93 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.70 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|