About 2,4-bis(dimethylamino)cyclohexane-1,3-diol
2,4-bis(dimethylamino)cyclohexane-1,3-diol (PubChem CID 12732268) has the molecular formula C10H22N2O2
and a molecular weight of 202.30 g/mol. Its IUPAC name is 2,4-bis(dimethylamino)cyclohexane-1,3-diol.
Molecular Properties
| Compound Name | 2,4-bis(dimethylamino)cyclohexane-1,3-diol |
| PubChem CID | 12732268 |
| Molecular Formula | C10H22N2O2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.17 |
| IUPAC Name | 2,4-bis(dimethylamino)cyclohexane-1,3-diol |
| SMILES | CN(C)C1CCC(O)C(N(C)C)C1O |
| InChI | InChI=1S/C10H22N2O2/c1-11(2)7-5-6-8(13)9(10(7)14)12(3)4/h7-10,13-14H,5-6H2,1-4H3 |
| InChIKey | DZNXIKDDPMNKAT-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 46.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,4-bis(dimethylamino)cyclohexane-1,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,4-bis(dimethylamino)cyclohexane-1,3-diol?
The IUPAC name of 2,4-bis(dimethylamino)cyclohexane-1,3-diol (CID 12732268) is 2,4-bis(dimethylamino)cyclohexane-1,3-diol.
What is the SMILES notation for 2,4-bis(dimethylamino)cyclohexane-1,3-diol?
The canonical SMILES for 2,4-bis(dimethylamino)cyclohexane-1,3-diol is CN(C)C1CCC(O)C(N(C)C)C1O.
What is the InChIKey of 2,4-bis(dimethylamino)cyclohexane-1,3-diol?
The InChIKey is DZNXIKDDPMNKAT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H22N2O2/c1-11(2)7-5-6-8(13)9(10(7)14)12(3)4/h7-10,13-14H,5-6H2,1-4H3.
What are the key properties of 2,4-bis(dimethylamino)cyclohexane-1,3-diol?
2,4-bis(dimethylamino)cyclohexane-1,3-diol has a molecular weight of 202.30 g/mol, XLogP of -0.64, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,4-bis(dimethylamino)cyclohexane-1,3-diol is sourced from PubChem (CID 12732268), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).