C20H20N4O — CID 127323044
2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-5-methyl-1,3-benzoxazole (PubChem CID 127323044) has the molecular formula C20H20N4O and a molecular weight of 332.41 g/mol. Its IUPAC name is 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-5-methyl-1,3-benzoxazole.
| Compound Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-5-methyl-1,3-benzoxazole |
|---|---|
| PubChem CID | 127323044 |
| Molecular Formula | C20H20N4O |
| Molecular Weight | 332.41 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | 2-[4-(1H-benzimidazol-2-yl)piperidin-1-yl]-5-methyl-1,3-benzoxazole |
| SMILES | Cc1ccc2oc(N3CCC(c4nc5ccccc5[nH]4)CC3)nc2c1 |
| InChI | InChI=1S/C20H20N4O/c1-13-6-7-18-17(12-13)23-20(25-18)24-10-8-14(9-11-24)19-21-15-4-2-3-5-16(15)22-19/h2-7,12,14H,8-11H2,1H3,(H,21,22) |
| InChIKey | YXCLVEGNDZCKRE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 57.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.41 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |