About 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one
1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one (PubChem CID 1273250) has the molecular formula C10H19NO2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one.
Molecular Properties
| Compound Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one |
| PubChem CID | 1273250 |
| Molecular Formula | C10H19NO2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.14 |
| IUPAC Name | 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one |
| SMILES | CC(C)C(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C10H19NO2/c1-7(2)10(12)11-5-8(3)13-9(4)6-11/h7-9H,5-6H2,1-4H3/t8-,9+ |
| InChIKey | MLYXDQMIWOFCIM-DTORHVGOSA-N |
| XLogP | 1.28 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one?
The IUPAC name of 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one (CID 1273250) is 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one.
What is the SMILES notation for 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one?
The canonical SMILES for 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one is CC(C)C(=O)N1C[C@@H](C)O[C@@H](C)C1.
What is the InChIKey of 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one?
The InChIKey is MLYXDQMIWOFCIM-DTORHVGOSA-N. The full InChI is InChI=1S/C10H19NO2/c1-7(2)10(12)11-5-8(3)13-9(4)6-11/h7-9H,5-6H2,1-4H3/t8-,9+.
What are the key properties of 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one?
1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one has a molecular weight of 185.27 g/mol, XLogP of 1.28, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(2R,6S)-2,6-dimethylmorpholin-4-yl]-2-methylpropan-1-one is sourced from PubChem (CID 1273250), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).