About N-(4-acetamidophenyl)-3,3-diphenylpropanamide
N-(4-acetamidophenyl)-3,3-diphenylpropanamide (PubChem CID 1273259) has the molecular formula C23H22N2O2
and a molecular weight of 358.44 g/mol. Its IUPAC name is N-(4-acetamidophenyl)-3,3-diphenylpropanamide.
Molecular Properties
| Compound Name | N-(4-acetamidophenyl)-3,3-diphenylpropanamide |
| PubChem CID | 1273259 |
| Molecular Formula | C23H22N2O2 |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.17 |
| IUPAC Name | N-(4-acetamidophenyl)-3,3-diphenylpropanamide |
| SMILES | CC(=O)Nc1ccc(NC(=O)CC(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C23H22N2O2/c1-17(26)24-20-12-14-21(15-13-20)25-23(27)16-22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,22H,16H2,1H3,(H,24,26)(H,25,27) |
| InChIKey | PRBJSHUDIRYOCK-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-(4-acetamidophenyl)-3,3-diphenylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(4-acetamidophenyl)-3,3-diphenylpropanamide?
The IUPAC name of N-(4-acetamidophenyl)-3,3-diphenylpropanamide (CID 1273259) is N-(4-acetamidophenyl)-3,3-diphenylpropanamide.
What is the SMILES notation for N-(4-acetamidophenyl)-3,3-diphenylpropanamide?
The canonical SMILES for N-(4-acetamidophenyl)-3,3-diphenylpropanamide is CC(=O)Nc1ccc(NC(=O)CC(c2ccccc2)c2ccccc2)cc1.
What is the InChIKey of N-(4-acetamidophenyl)-3,3-diphenylpropanamide?
The InChIKey is PRBJSHUDIRYOCK-UHFFFAOYSA-N. The full InChI is InChI=1S/C23H22N2O2/c1-17(26)24-20-12-14-21(15-13-20)25-23(27)16-22(18-8-4-2-5-9-18)19-10-6-3-7-11-19/h2-15,22H,16H2,1H3,(H,24,26)(H,25,27).
What are the key properties of N-(4-acetamidophenyl)-3,3-diphenylpropanamide?
N-(4-acetamidophenyl)-3,3-diphenylpropanamide has a molecular weight of 358.44 g/mol, XLogP of 4.81, 6 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(4-acetamidophenyl)-3,3-diphenylpropanamide is sourced from PubChem (CID 1273259), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).