About 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole
3-thiophen-2-yl-4,5-dihydro-1,2-oxazole (PubChem CID 12732784) has the molecular formula C7H7NOS
and a molecular weight of 153.21 g/mol. Its IUPAC name is 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole.
Molecular Properties
| Compound Name | 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole |
| PubChem CID | 12732784 |
| Molecular Formula | C7H7NOS |
| Molecular Weight | 153.21 g/mol |
| Exact Mass | 153.02 |
| IUPAC Name | 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole |
| SMILES | c1csc(C2=NOCC2)c1 |
| InChI | InChI=1S/C7H7NOS/c1-2-7(10-5-1)6-3-4-9-8-6/h1-2,5H,3-4H2 |
| InChIKey | HKDZOXYTRKMEAG-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 153.21 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole?
The IUPAC name of 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole (CID 12732784) is 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole.
What is the SMILES notation for 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole?
The canonical SMILES for 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole is c1csc(C2=NOCC2)c1.
What is the InChIKey of 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole?
The InChIKey is HKDZOXYTRKMEAG-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS/c1-2-7(10-5-1)6-3-4-9-8-6/h1-2,5H,3-4H2.
What are the key properties of 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole?
3-thiophen-2-yl-4,5-dihydro-1,2-oxazole has a molecular weight of 153.21 g/mol, XLogP of 1.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-thiophen-2-yl-4,5-dihydro-1,2-oxazole is sourced from PubChem (CID 12732784), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).