C9H15F6O3P — CID 12732919
triethoxy(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-λ5-phosphane (PubChem CID 12732919) has the molecular formula C9H15F6O3P and a molecular weight of 316.18 g/mol. Its IUPAC name is triethoxy(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-λ5-phosphane.
| Compound Name | triethoxy(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-λ5-phosphane |
|---|---|
| PubChem CID | 12732919 |
| Molecular Formula | C9H15F6O3P |
| Molecular Weight | 316.18 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | triethoxy(1,1,1,3,3,3-hexafluoropropan-2-ylidene)-λ5-phosphane |
| SMILES | CCOP(OCC)(OCC)=C(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H15F6O3P/c1-4-16-19(17-5-2,18-6-3)7(8(10,11)12)9(13,14)15/h4-6H2,1-3H3 |
| InChIKey | PIGQZHPOWGPCAL-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.18 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|