About 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea
1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea (PubChem CID 12733184) has the molecular formula C16H17N3O2
and a molecular weight of 283.33 g/mol. Its IUPAC name is 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea.
Molecular Properties
| Compound Name | 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea |
| PubChem CID | 12733184 |
| Molecular Formula | C16H17N3O2 |
| Molecular Weight | 283.33 g/mol |
| Exact Mass | 283.13 |
| IUPAC Name | 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea |
| SMILES | CNC(=O)N(C)C1c2cc(C)ccc2Oc2ncccc21 |
| InChI | InChI=1S/C16H17N3O2/c1-10-6-7-13-12(9-10)14(19(3)16(20)17-2)11-5-4-8-18-15(11)21-13/h4-9,14H,1-3H3,(H,17,20) |
| InChIKey | KENYSAPTWKJIMW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea?
The IUPAC name of 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea (CID 12733184) is 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea.
What is the SMILES notation for 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea?
The canonical SMILES for 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea is CNC(=O)N(C)C1c2cc(C)ccc2Oc2ncccc21.
What is the InChIKey of 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea?
The InChIKey is KENYSAPTWKJIMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17N3O2/c1-10-6-7-13-12(9-10)14(19(3)16(20)17-2)11-5-4-8-18-15(11)21-13/h4-9,14H,1-3H3,(H,17,20).
What are the key properties of 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea?
1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea has a molecular weight of 283.33 g/mol, XLogP of 2.86, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dimethyl-1-(7-methyl-5H-chromeno[2,3-b]pyridin-5-yl)urea is sourced from PubChem (CID 12733184), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).