4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid

C9H9NO3 — CID 12733398

IUPAC4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid
SMILESCCn1c(C(=O)O)cc2occc21
InChIInChI=1S/C9H9NO3/c1-2-10-6-3-4-13-8(6)5-7(10)9(11)12/h3-5H,2H2,1H3,(H,11,12)
InChIKeyWRBYXSDFHASHHE-UHFFFAOYSA-N
MW179.17 g/mol
LogP1.95
Rot. Bonds2

About 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid

4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 12733398) has the molecular formula C9H9NO3 and a molecular weight of 179.17 g/mol. Its IUPAC name is 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid.

Molecular Properties

Compound Name4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid
PubChem CID12733398
Molecular FormulaC9H9NO3
Molecular Weight179.17 g/mol
Exact Mass179.06
IUPAC Name4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid
SMILESCCn1c(C(=O)O)cc2occc21
InChIInChI=1S/C9H9NO3/c1-2-10-6-3-4-13-8(6)5-7(10)9(11)12/h3-5H,2H2,1H3,(H,11,12)
InChIKeyWRBYXSDFHASHHE-UHFFFAOYSA-N
XLogP1.95
TPSA55.37 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds2
Heavy Atoms13
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500179.17
LogP ≤ 51.95
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid (CID 12733398) is 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid is CCn1c(C(=O)O)cc2occc21.
What is the InChIKey of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is WRBYXSDFHASHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-2-10-6-3-4-13-8(6)5-7(10)9(11)12/h3-5H,2H2,1H3,(H,11,12).
What are the key properties of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 179.17 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 12733398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).