About 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid
4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid (PubChem CID 12733398) has the molecular formula C9H9NO3
and a molecular weight of 179.17 g/mol. Its IUPAC name is 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid.
Molecular Properties
| Compound Name | 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid |
| PubChem CID | 12733398 |
| Molecular Formula | C9H9NO3 |
| Molecular Weight | 179.17 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid |
| SMILES | CCn1c(C(=O)O)cc2occc21 |
| InChI | InChI=1S/C9H9NO3/c1-2-10-6-3-4-13-8(6)5-7(10)9(11)12/h3-5H,2H2,1H3,(H,11,12) |
| InChIKey | WRBYXSDFHASHHE-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 55.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.17 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
The IUPAC name of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid (CID 12733398) is 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid.
What is the SMILES notation for 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
The canonical SMILES for 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid is CCn1c(C(=O)O)cc2occc21.
What is the InChIKey of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
The InChIKey is WRBYXSDFHASHHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9NO3/c1-2-10-6-3-4-13-8(6)5-7(10)9(11)12/h3-5H,2H2,1H3,(H,11,12).
What are the key properties of 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid?
4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid has a molecular weight of 179.17 g/mol, XLogP of 1.95, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethylfuro[3,2-b]pyrrole-5-carboxylic acid is sourced from PubChem (CID 12733398), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).