About 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride
2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride (PubChem CID 12734178) has the molecular formula C16H19ClN2OS
and a molecular weight of 322.86 g/mol. Its IUPAC name is 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride.
Molecular Properties
| Compound Name | 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride |
| PubChem CID | 12734178 |
| Molecular Formula | C16H19ClN2OS |
| Molecular Weight | 322.86 g/mol |
| Exact Mass | 322.09 |
| IUPAC Name | 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride |
| SMILES | CN(C)CCSC1c2ccccc2Oc2ncccc21.Cl |
| InChI | InChI=1S/C16H18N2OS.ClH/c1-18(2)10-11-20-15-12-6-3-4-8-14(12)19-16-13(15)7-5-9-17-16;/h3-9,15H,10-11H2,1-2H3;1H |
| InChIKey | OFOZJHHTNBNVCZ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 25.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 322.86 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride?
The IUPAC name of 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride (CID 12734178) is 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride.
What is the SMILES notation for 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride?
The canonical SMILES for 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride is CN(C)CCSC1c2ccccc2Oc2ncccc21.Cl.
What is the InChIKey of 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride?
The InChIKey is OFOZJHHTNBNVCZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H18N2OS.ClH/c1-18(2)10-11-20-15-12-6-3-4-8-14(12)19-16-13(15)7-5-9-17-16;/h3-9,15H,10-11H2,1-2H3;1H.
What are the key properties of 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride?
2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride has a molecular weight of 322.86 g/mol, XLogP of 3.99, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(5H-chromeno[2,3-b]pyridin-5-ylsulfanyl)-N,N-dimethylethanamine;hydrochloride is sourced from PubChem (CID 12734178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).