C14H24N2S4 — CID 12734535
[(1E,3E)-4-(diethylcarbamothioylsulfanyl)buta-1,3-dienyl] N,N-diethylcarbamodithioate (PubChem CID 12734535) has the molecular formula C14H24N2S4 and a molecular weight of 348.63 g/mol. Its IUPAC name is [(1E,3E)-4-(diethylcarbamothioylsulfanyl)buta-1,3-dienyl] N,N-diethylcarbamodithioate.
| Compound Name | [(1E,3E)-4-(diethylcarbamothioylsulfanyl)buta-1,3-dienyl] N,N-diethylcarbamodithioate |
|---|---|
| PubChem CID | 12734535 |
| Molecular Formula | C14H24N2S4 |
| Molecular Weight | 348.63 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | [(1E,3E)-4-(diethylcarbamothioylsulfanyl)buta-1,3-dienyl] N,N-diethylcarbamodithioate |
| SMILES | CCN(CC)C(=S)S/C=C/C=C/SC(=S)N(CC)CC |
| InChI | InChI=1S/C14H24N2S4/c1-5-15(6-2)13(17)19-11-9-10-12-20-14(18)16(7-3)8-4/h9-12H,5-8H2,1-4H3/b11-9+,12-10+ |
| InChIKey | SYCMIYVPLDPSBY-WGDLNXRISA-N |
| XLogP | 4.73 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.63 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|