About (E)-undec-6-en-3-ol
(E)-undec-6-en-3-ol (PubChem CID 12734626) has the molecular formula C11H22O
and a molecular weight of 170.30 g/mol. Its IUPAC name is (E)-undec-6-en-3-ol.
Molecular Properties
| Compound Name | (E)-undec-6-en-3-ol |
| PubChem CID | 12734626 |
| Molecular Formula | C11H22O |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.17 |
| IUPAC Name | (E)-undec-6-en-3-ol |
| SMILES | CCCC/C=C/CCC(O)CC |
| InChI | InChI=1S/C11H22O/c1-3-5-6-7-8-9-10-11(12)4-2/h7-8,11-12H,3-6,9-10H2,1-2H3/b8-7+ |
| InChIKey | MXRIMDGIWUYWAK-BQYQJAHWSA-N |
| XLogP | 3.28 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (E)-undec-6-en-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-undec-6-en-3-ol?
The IUPAC name of (E)-undec-6-en-3-ol (CID 12734626) is (E)-undec-6-en-3-ol.
What is the SMILES notation for (E)-undec-6-en-3-ol?
The canonical SMILES for (E)-undec-6-en-3-ol is CCCC/C=C/CCC(O)CC.
What is the InChIKey of (E)-undec-6-en-3-ol?
The InChIKey is MXRIMDGIWUYWAK-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H22O/c1-3-5-6-7-8-9-10-11(12)4-2/h7-8,11-12H,3-6,9-10H2,1-2H3/b8-7+.
What are the key properties of (E)-undec-6-en-3-ol?
(E)-undec-6-en-3-ol has a molecular weight of 170.30 g/mol, XLogP of 3.28, 7 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-undec-6-en-3-ol is sourced from PubChem (CID 12734626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).