About octan-2-amine
octan-2-amine (PubChem CID 12735) has the molecular formula C8H19N
and a molecular weight of 129.25 g/mol. Its IUPAC name is octan-2-amine.
Molecular Properties
| Compound Name | octan-2-amine |
| PubChem CID | 12735 |
| Molecular Formula | C8H19N |
| Molecular Weight | 129.25 g/mol |
| Exact Mass | 129.15 |
| IUPAC Name | octan-2-amine |
| SMILES | CCCCCCC(C)N |
| InChI | InChI=1S/C8H19N/c1-3-4-5-6-7-8(2)9/h8H,3-7,9H2,1-2H3 |
| InChIKey | HBXNJMZWGSCKPW-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 129.25 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze octan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of octan-2-amine?
The IUPAC name of octan-2-amine (CID 12735) is octan-2-amine.
What is the SMILES notation for octan-2-amine?
The canonical SMILES for octan-2-amine is CCCCCCC(C)N.
What is the InChIKey of octan-2-amine?
The InChIKey is HBXNJMZWGSCKPW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H19N/c1-3-4-5-6-7-8(2)9/h8H,3-7,9H2,1-2H3.
What are the key properties of octan-2-amine?
octan-2-amine has a molecular weight of 129.25 g/mol, XLogP of 2.30, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for octan-2-amine is sourced from PubChem (CID 12735), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).