C12H22O2 — CID 12735279
(1E,3E)-1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diene (PubChem CID 12735279) has the molecular formula C12H22O2 and a molecular weight of 198.31 g/mol. Its IUPAC name is (1E,3E)-1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diene.
| Compound Name | (1E,3E)-1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diene |
|---|---|
| PubChem CID | 12735279 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (1E,3E)-1,4-bis[(2-methylpropan-2-yl)oxy]buta-1,3-diene |
| SMILES | CC(C)(C)O/C=C/C=C/OC(C)(C)C |
| InChI | InChI=1S/C12H22O2/c1-11(2,3)13-9-7-8-10-14-12(4,5)6/h7-10H,1-6H3/b9-7+,10-8+ |
| InChIKey | WUWGWKUDZRXHDN-FIFLTTCUSA-N |
| XLogP | 3.64 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|