About 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride
3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride (PubChem CID 12735520) has the molecular formula C30H30BFO4S2
and a molecular weight of 548.51 g/mol. Its IUPAC name is 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride.
Molecular Properties
| Compound Name | 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride |
| PubChem CID | 12735520 |
| Molecular Formula | C30H30BFO4S2 |
| Molecular Weight | 548.51 g/mol |
| Exact Mass | 548.17 |
| IUPAC Name | 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride |
| SMILES | Cc1cc(C)c(B(c2ccc(S(=O)(=O)c3cccc(S(=O)(=O)F)c3)cc2)c2c(C)cc(C)cc2C)c(C)c1 |
| InChI | InChI=1S/C30H30BFO4S2/c1-19-14-21(3)29(22(4)15-19)31(30-23(5)16-20(2)17-24(30)6)25-10-12-26(13-11-25)37(33,34)27-8-7-9-28(18-27)38(32,35)36/h7-18H,1-6H3 |
| InChIKey | HVWMGELTDQACHA-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 68.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 548.51 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride?
The IUPAC name of 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride (CID 12735520) is 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride.
What is the SMILES notation for 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride?
The canonical SMILES for 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride is Cc1cc(C)c(B(c2ccc(S(=O)(=O)c3cccc(S(=O)(=O)F)c3)cc2)c2c(C)cc(C)cc2C)c(C)c1.
What is the InChIKey of 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride?
The InChIKey is HVWMGELTDQACHA-UHFFFAOYSA-N. The full InChI is InChI=1S/C30H30BFO4S2/c1-19-14-21(3)29(22(4)15-19)31(30-23(5)16-20(2)17-24(30)6)25-10-12-26(13-11-25)37(33,34)27-8-7-9-28(18-27)38(32,35)36/h7-18H,1-6H3.
What are the key properties of 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride?
3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride has a molecular weight of 548.51 g/mol, XLogP of 4.54, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[4-bis(2,4,6-trimethylphenyl)boranylphenyl]sulfonylbenzenesulfonyl fluoride is sourced from PubChem (CID 12735520), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).