About 3-trimethylsilylfuran-2,5-dione
3-trimethylsilylfuran-2,5-dione (PubChem CID 12736479) has the molecular formula C7H10O3Si
and a molecular weight of 170.24 g/mol. Its IUPAC name is 3-trimethylsilylfuran-2,5-dione.
Molecular Properties
| Compound Name | 3-trimethylsilylfuran-2,5-dione |
| PubChem CID | 12736479 |
| Molecular Formula | C7H10O3Si |
| Molecular Weight | 170.24 g/mol |
| Exact Mass | 170.04 |
| IUPAC Name | 3-trimethylsilylfuran-2,5-dione |
| SMILES | C[Si](C)(C)C1=CC(=O)OC1=O |
| InChI | InChI=1S/C7H10O3Si/c1-11(2,3)5-4-6(8)10-7(5)9/h4H,1-3H3 |
| InChIKey | KLCDAXISMIFSGZ-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.24 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 3-trimethylsilylfuran-2,5-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-trimethylsilylfuran-2,5-dione?
The IUPAC name of 3-trimethylsilylfuran-2,5-dione (CID 12736479) is 3-trimethylsilylfuran-2,5-dione.
What is the SMILES notation for 3-trimethylsilylfuran-2,5-dione?
The canonical SMILES for 3-trimethylsilylfuran-2,5-dione is C[Si](C)(C)C1=CC(=O)OC1=O.
What is the InChIKey of 3-trimethylsilylfuran-2,5-dione?
The InChIKey is KLCDAXISMIFSGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O3Si/c1-11(2,3)5-4-6(8)10-7(5)9/h4H,1-3H3.
What are the key properties of 3-trimethylsilylfuran-2,5-dione?
3-trimethylsilylfuran-2,5-dione has a molecular weight of 170.24 g/mol, XLogP of 0.87, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-trimethylsilylfuran-2,5-dione is sourced from PubChem (CID 12736479), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).