C16H36Si4 — CID 12736487
trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,2,3-trienyl]silane (PubChem CID 12736487) has the molecular formula C16H36Si4 and a molecular weight of 340.81 g/mol. Its IUPAC name is trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,2,3-trienyl]silane.
| Compound Name | trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,2,3-trienyl]silane |
|---|---|
| PubChem CID | 12736487 |
| Molecular Formula | C16H36Si4 |
| Molecular Weight | 340.81 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | trimethyl-[1,4,4-tris(trimethylsilyl)buta-1,2,3-trienyl]silane |
| SMILES | C[Si](C)(C)C(=C=C=C([Si](C)(C)C)[Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C16H36Si4/c1-17(2,3)15(18(4,5)6)13-14-16(19(7,8)9)20(10,11)12/h1-12H3 |
| InChIKey | DQQJEDFBWHWTQL-UHFFFAOYSA-N |
| XLogP | 6.10 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.81 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|