About 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one
2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one (PubChem CID 12736612) has the molecular formula C4H8N4O
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one.
Molecular Properties
| Compound Name | 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one |
| PubChem CID | 12736612 |
| Molecular Formula | C4H8N4O |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.07 |
| IUPAC Name | 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one |
| SMILES | NC1=NCC(N)C(=O)N1 |
| InChI | InChI=1S/C4H8N4O/c5-2-1-7-4(6)8-3(2)9/h2H,1,5H2,(H3,6,7,8,9) |
| InChIKey | YBZUJSGPOVUZSQ-UHFFFAOYSA-N |
| XLogP | -2.24 |
| TPSA | 93.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one?
The IUPAC name of 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one (CID 12736612) is 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one.
What is the SMILES notation for 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one?
The canonical SMILES for 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one is NC1=NCC(N)C(=O)N1.
What is the InChIKey of 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one?
The InChIKey is YBZUJSGPOVUZSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8N4O/c5-2-1-7-4(6)8-3(2)9/h2H,1,5H2,(H3,6,7,8,9).
What are the key properties of 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one?
2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one has a molecular weight of 128.13 g/mol, XLogP of -2.24, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-diamino-4,5-dihydro-1H-pyrimidin-6-one is sourced from PubChem (CID 12736612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).