About 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate
2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate (PubChem CID 12739187) has the molecular formula C9H12N2O4
and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate.
Molecular Properties
| Compound Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate |
| PubChem CID | 12739187 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate |
| SMILES | CC(=O)OCCc1c(C)[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C9H12N2O4/c1-5-7(3-4-15-6(2)12)8(13)11-9(14)10-5/h3-4H2,1-2H3,(H2,10,11,13,14) |
| InChIKey | IVIFEIOLKXCSSC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 92.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate?
The IUPAC name of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate (CID 12739187) is 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate.
What is the SMILES notation for 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate?
The canonical SMILES for 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate is CC(=O)OCCc1c(C)[nH]c(=O)[nH]c1=O.
What is the InChIKey of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate?
The InChIKey is IVIFEIOLKXCSSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N2O4/c1-5-7(3-4-15-6(2)12)8(13)11-9(14)10-5/h3-4H2,1-2H3,(H2,10,11,13,14).
What are the key properties of 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate?
2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate has a molecular weight of 212.20 g/mol, XLogP of -0.52, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(6-methyl-2,4-dioxo-1H-pyrimidin-5-yl)ethyl acetate is sourced from PubChem (CID 12739187), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).