About (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide
(4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide (PubChem CID 12739191) has the molecular formula C8H11BrN4OS
and a molecular weight of 291.17 g/mol. Its IUPAC name is (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide.
Molecular Properties
| Compound Name | (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide |
| PubChem CID | 12739191 |
| Molecular Formula | C8H11BrN4OS |
| Molecular Weight | 291.17 g/mol |
| Exact Mass | 289.98 |
| IUPAC Name | (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide |
| SMILES | Br.[H]/N=C(\N)Sc1nc(C)c2c(n1)OCC2 |
| InChI | InChI=1S/C8H10N4OS.BrH/c1-4-5-2-3-13-6(5)12-8(11-4)14-7(9)10;/h2-3H2,1H3,(H3,9,10);1H |
| InChIKey | NEEHOYJZBAJTLG-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 84.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.17 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide?
The IUPAC name of (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide (CID 12739191) is (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide.
What is the SMILES notation for (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide?
The canonical SMILES for (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide is Br.[H]/N=C(\N)Sc1nc(C)c2c(n1)OCC2.
What is the InChIKey of (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide?
The InChIKey is NEEHOYJZBAJTLG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N4OS.BrH/c1-4-5-2-3-13-6(5)12-8(11-4)14-7(9)10;/h2-3H2,1H3,(H3,9,10);1H.
What are the key properties of (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide?
(4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide has a molecular weight of 291.17 g/mol, XLogP of 1.28, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methyl-5,6-dihydrofuro[2,3-d]pyrimidin-2-yl) carbamimidothioate;hydrobromide is sourced from PubChem (CID 12739191), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).