C13H17N3O2 — CID 12739227
4,8-dimethyl-2,4,6-triazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5-dione (PubChem CID 12739227) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is 4,8-dimethyl-2,4,6-triazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5-dione.
| Compound Name | 4,8-dimethyl-2,4,6-triazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5-dione |
|---|---|
| PubChem CID | 12739227 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | 4,8-dimethyl-2,4,6-triazatetracyclo[5.5.2.02,6.08,12]tetradec-13-ene-3,5-dione |
| SMILES | Cn1c(=O)n2n(c1=O)C1C=CC2C2CCCC21C |
| InChI | InChI=1S/C13H17N3O2/c1-13-7-3-4-8(13)9-5-6-10(13)16-12(18)14(2)11(17)15(9)16/h5-6,8-10H,3-4,7H2,1-2H3 |
| InChIKey | CTMMZIXCTXKYQI-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 48.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|