About 3,7-dimethyloct-6-enoyl chloride
3,7-dimethyloct-6-enoyl chloride (PubChem CID 12739617) has the molecular formula C10H17ClO
and a molecular weight of 188.70 g/mol. Its IUPAC name is 3,7-dimethyloct-6-enoyl chloride.
Molecular Properties
| Compound Name | 3,7-dimethyloct-6-enoyl chloride |
| PubChem CID | 12739617 |
| Molecular Formula | C10H17ClO |
| Molecular Weight | 188.70 g/mol |
| Exact Mass | 188.10 |
| IUPAC Name | 3,7-dimethyloct-6-enoyl chloride |
| SMILES | CC(C)=CCCC(C)CC(=O)Cl |
| InChI | InChI=1S/C10H17ClO/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3 |
| InChIKey | NOXCOFIBMWWGPQ-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.70 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 3,7-dimethyloct-6-enoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,7-dimethyloct-6-enoyl chloride?
The IUPAC name of 3,7-dimethyloct-6-enoyl chloride (CID 12739617) is 3,7-dimethyloct-6-enoyl chloride.
What is the SMILES notation for 3,7-dimethyloct-6-enoyl chloride?
The canonical SMILES for 3,7-dimethyloct-6-enoyl chloride is CC(C)=CCCC(C)CC(=O)Cl.
What is the InChIKey of 3,7-dimethyloct-6-enoyl chloride?
The InChIKey is NOXCOFIBMWWGPQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17ClO/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3.
What are the key properties of 3,7-dimethyloct-6-enoyl chloride?
3,7-dimethyloct-6-enoyl chloride has a molecular weight of 188.70 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,7-dimethyloct-6-enoyl chloride is sourced from PubChem (CID 12739617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).