(3R)-3,7-dimethyloct-6-enoyl chloride

C10H17ClO — CID 12739619

IUPAC(3R)-3,7-dimethyloct-6-enoyl chloride
SMILESCC(C)=CCC[C@@H](C)CC(=O)Cl
InChIInChI=1S/C10H17ClO/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3/t9-/m1/s1
InChIKeyNOXCOFIBMWWGPQ-SECBINFHSA-N
MW188.70 g/mol
LogP3.52
Rot. Bonds5

About (3R)-3,7-dimethyloct-6-enoyl chloride

(3R)-3,7-dimethyloct-6-enoyl chloride (PubChem CID 12739619) has the molecular formula C10H17ClO and a molecular weight of 188.70 g/mol. Its IUPAC name is (3R)-3,7-dimethyloct-6-enoyl chloride.

Molecular Properties

Compound Name(3R)-3,7-dimethyloct-6-enoyl chloride
PubChem CID12739619
Molecular FormulaC10H17ClO
Molecular Weight188.70 g/mol
Exact Mass188.10
IUPAC Name(3R)-3,7-dimethyloct-6-enoyl chloride
SMILESCC(C)=CCC[C@@H](C)CC(=O)Cl
InChIInChI=1S/C10H17ClO/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3/t9-/m1/s1
InChIKeyNOXCOFIBMWWGPQ-SECBINFHSA-N
XLogP3.52
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms12
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500188.70
LogP ≤ 53.52
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze (3R)-3,7-dimethyloct-6-enoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3R)-3,7-dimethyloct-6-enoyl chloride?
The IUPAC name of (3R)-3,7-dimethyloct-6-enoyl chloride (CID 12739619) is (3R)-3,7-dimethyloct-6-enoyl chloride.
What is the SMILES notation for (3R)-3,7-dimethyloct-6-enoyl chloride?
The canonical SMILES for (3R)-3,7-dimethyloct-6-enoyl chloride is CC(C)=CCC[C@@H](C)CC(=O)Cl.
What is the InChIKey of (3R)-3,7-dimethyloct-6-enoyl chloride?
The InChIKey is NOXCOFIBMWWGPQ-SECBINFHSA-N. The full InChI is InChI=1S/C10H17ClO/c1-8(2)5-4-6-9(3)7-10(11)12/h5,9H,4,6-7H2,1-3H3/t9-/m1/s1.
What are the key properties of (3R)-3,7-dimethyloct-6-enoyl chloride?
(3R)-3,7-dimethyloct-6-enoyl chloride has a molecular weight of 188.70 g/mol, XLogP of 3.52, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (3R)-3,7-dimethyloct-6-enoyl chloride is sourced from PubChem (CID 12739619), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).