About 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one
9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one (PubChem CID 127406584) has the molecular formula C11H13N3O3
and a molecular weight of 235.24 g/mol. Its IUPAC name is 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one.
Molecular Properties
| Compound Name | 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one |
| PubChem CID | 127406584 |
| Molecular Formula | C11H13N3O3 |
| Molecular Weight | 235.24 g/mol |
| Exact Mass | 235.10 |
| IUPAC Name | 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one |
| SMILES | O=C1CC2CCC(CN1)N2C(=O)c1ccon1 |
| InChI | InChI=1S/C11H13N3O3/c15-10-5-7-1-2-8(6-12-10)14(7)11(16)9-3-4-17-13-9/h3-4,7-8H,1-2,5-6H2,(H,12,15) |
| InChIKey | DROISPBRTMONNG-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.24 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
The IUPAC name of 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one (CID 127406584) is 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one.
What is the SMILES notation for 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
The canonical SMILES for 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one is O=C1CC2CCC(CN1)N2C(=O)c1ccon1.
What is the InChIKey of 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
The InChIKey is DROISPBRTMONNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3O3/c15-10-5-7-1-2-8(6-12-10)14(7)11(16)9-3-4-17-13-9/h3-4,7-8H,1-2,5-6H2,(H,12,15).
What are the key properties of 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one?
9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one has a molecular weight of 235.24 g/mol, XLogP of 0.17, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(1,2-oxazole-3-carbonyl)-3,9-diazabicyclo[4.2.1]nonan-4-one is sourced from PubChem (CID 127406584), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).