C21H30Si — CID 12740719
5-(2-adamantylidene)penta-1,2,3,4-tetraenyl-triethylsilane (PubChem CID 12740719) has the molecular formula C21H30Si and a molecular weight of 310.56 g/mol. Its IUPAC name is 5-(2-adamantylidene)penta-1,2,3,4-tetraenyl-triethylsilane.
| Compound Name | 5-(2-adamantylidene)penta-1,2,3,4-tetraenyl-triethylsilane |
|---|---|
| PubChem CID | 12740719 |
| Molecular Formula | C21H30Si |
| Molecular Weight | 310.56 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | 5-(2-adamantylidene)penta-1,2,3,4-tetraenyl-triethylsilane |
| SMILES | CC[Si](C=C=C=C=C=C1C2CC3CC(C2)CC1C3)(CC)CC |
| InChI | InChI=1S/C21H30Si/c1-4-22(5-2,6-3)11-9-7-8-10-21-19-13-17-12-18(15-19)16-20(21)14-17/h11,17-20H,4-6,12-16H2,1-3H3 |
| InChIKey | XCCGPVRLXZELID-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.56 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|