About CID 12740732
CID 12740732 (PubChem CID 12740732) has the molecular formula C28H32
and a molecular weight of 368.56 g/mol.
Molecular Properties
| Compound Name | CID 12740732 |
| PubChem CID | 12740732 |
| Molecular Formula | C28H32 |
| Molecular Weight | 368.56 g/mol |
| Exact Mass | 368.25 |
| IUPAC Name | — |
| SMILES | CC1(C)C#CC#CC2(C3CCCCC32)C2(C#CC#CC1(C)C)C1CCCCC12 |
| InChI | InChI=1S/C28H32/c1-25(2)17-9-11-19-27(21-13-5-6-14-22(21)27)28(20-12-10-18-26(25,3)4)23-15-7-8-16-24(23)28/h21-24H,5-8,13-16H2,1-4H3 |
| InChIKey | CXLCTELZVGCBSO-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.56 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 12740732 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12740732?
The IUPAC name of CID 12740732 (CID 12740732) is not available.
What is the SMILES notation for CID 12740732?
The canonical SMILES for CID 12740732 is CC1(C)C#CC#CC2(C3CCCCC32)C2(C#CC#CC1(C)C)C1CCCCC12.
What is the InChIKey of CID 12740732?
The InChIKey is CXLCTELZVGCBSO-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H32/c1-25(2)17-9-11-19-27(21-13-5-6-14-22(21)27)28(20-12-10-18-26(25,3)4)23-15-7-8-16-24(23)28/h21-24H,5-8,13-16H2,1-4H3.
What are the key properties of CID 12740732?
CID 12740732 has a molecular weight of 368.56 g/mol, XLogP of 5.68, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12740732 is sourced from PubChem (CID 12740732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).