C26H26N2O4S2 — CID 1274088
1-N,5-N-bis[(1S)-1-phenylethyl]naphthalene-1,5-disulfonamide (PubChem CID 1274088) has the molecular formula C26H26N2O4S2 and a molecular weight of 494.64 g/mol. Its IUPAC name is 1-N,5-N-bis[(1S)-1-phenylethyl]naphthalene-1,5-disulfonamide.
| Compound Name | 1-N,5-N-bis[(1S)-1-phenylethyl]naphthalene-1,5-disulfonamide |
|---|---|
| PubChem CID | 1274088 |
| Molecular Formula | C26H26N2O4S2 |
| Molecular Weight | 494.64 g/mol |
| Exact Mass | 494.13 |
| IUPAC Name | 1-N,5-N-bis[(1S)-1-phenylethyl]naphthalene-1,5-disulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1cccc2c(S(=O)(=O)N[C@@H](C)c3ccccc3)cccc12)c1ccccc1 |
| InChI | InChI=1S/C26H26N2O4S2/c1-19(21-11-5-3-6-12-21)27-33(29,30)25-17-9-16-24-23(25)15-10-18-26(24)34(31,32)28-20(2)22-13-7-4-8-14-22/h3-20,27-28H,1-2H3/t19-,20-/m0/s1 |
| InChIKey | RLHPNFPFPPWBAZ-PMACEKPBSA-N |
| XLogP | 4.92 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.64 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |