C14H21NO — CID 12741417
8-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine (PubChem CID 12741417) has the molecular formula C14H21NO and a molecular weight of 219.33 g/mol. Its IUPAC name is 8-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine.
| Compound Name | 8-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
|---|---|
| PubChem CID | 12741417 |
| Molecular Formula | C14H21NO |
| Molecular Weight | 219.33 g/mol |
| Exact Mass | 219.16 |
| IUPAC Name | 8-methoxy-N-propyl-1,2,3,4-tetrahydronaphthalen-2-amine |
| SMILES | CCCNC1CCc2cccc(OC)c2C1 |
| InChI | InChI=1S/C14H21NO/c1-3-9-15-12-8-7-11-5-4-6-14(16-2)13(11)10-12/h4-6,12,15H,3,7-10H2,1-2H3 |
| InChIKey | MLSPZCYBIFMZQH-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.33 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |