About 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone
1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone (PubChem CID 127417127) has the molecular formula C12H19N3O2
and a molecular weight of 237.30 g/mol. Its IUPAC name is 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone |
| PubChem CID | 127417127 |
| Molecular Formula | C12H19N3O2 |
| Molecular Weight | 237.30 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone |
| SMILES | CC(=O)N1CCC(c2nc(C(C)(C)C)no2)C1 |
| InChI | InChI=1S/C12H19N3O2/c1-8(16)15-6-5-9(7-15)10-13-11(14-17-10)12(2,3)4/h9H,5-7H2,1-4H3 |
| InChIKey | QQLGSBOLMXDFAA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 59.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.30 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone?
The IUPAC name of 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone (CID 127417127) is 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone.
What is the SMILES notation for 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone?
The canonical SMILES for 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone is CC(=O)N1CCC(c2nc(C(C)(C)C)no2)C1.
What is the InChIKey of 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone?
The InChIKey is QQLGSBOLMXDFAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O2/c1-8(16)15-6-5-9(7-15)10-13-11(14-17-10)12(2,3)4/h9H,5-7H2,1-4H3.
What are the key properties of 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone?
1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone has a molecular weight of 237.30 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[3-(3-tert-butyl-1,2,4-oxadiazol-5-yl)pyrrolidin-1-yl]ethanone is sourced from PubChem (CID 127417127), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).