About 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one
3-(ethoxymethyl)-1,1-dioxothiochromen-4-one (PubChem CID 12741890) has the molecular formula C12H12O4S
and a molecular weight of 252.29 g/mol. Its IUPAC name is 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one.
Molecular Properties
| Compound Name | 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one |
| PubChem CID | 12741890 |
| Molecular Formula | C12H12O4S |
| Molecular Weight | 252.29 g/mol |
| Exact Mass | 252.05 |
| IUPAC Name | 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one |
| SMILES | CCOCC1=CS(=O)(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C12H12O4S/c1-2-16-7-9-8-17(14,15)11-6-4-3-5-10(11)12(9)13/h3-6,8H,2,7H2,1H3 |
| InChIKey | FKYGIQFUEZIORU-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.29 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one?
The IUPAC name of 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one (CID 12741890) is 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one.
What is the SMILES notation for 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one?
The canonical SMILES for 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one is CCOCC1=CS(=O)(=O)c2ccccc2C1=O.
What is the InChIKey of 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one?
The InChIKey is FKYGIQFUEZIORU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12O4S/c1-2-16-7-9-8-17(14,15)11-6-4-3-5-10(11)12(9)13/h3-6,8H,2,7H2,1H3.
What are the key properties of 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one?
3-(ethoxymethyl)-1,1-dioxothiochromen-4-one has a molecular weight of 252.29 g/mol, XLogP of 1.58, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(ethoxymethyl)-1,1-dioxothiochromen-4-one is sourced from PubChem (CID 12741890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).