About 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one
3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one (PubChem CID 12741894) has the molecular formula C12H11ClO4S
and a molecular weight of 286.74 g/mol. Its IUPAC name is 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one.
Molecular Properties
| Compound Name | 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one |
| PubChem CID | 12741894 |
| Molecular Formula | C12H11ClO4S |
| Molecular Weight | 286.74 g/mol |
| Exact Mass | 286.01 |
| IUPAC Name | 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one |
| SMILES | O=C1C(COCCCl)=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C12H11ClO4S/c13-5-6-17-7-9-8-18(15,16)11-4-2-1-3-10(11)12(9)14/h1-4,8H,5-7H2 |
| InChIKey | HARAMUQUMADASW-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 286.74 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one?
The IUPAC name of 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one (CID 12741894) is 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one.
What is the SMILES notation for 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one?
The canonical SMILES for 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one is O=C1C(COCCCl)=CS(=O)(=O)c2ccccc21.
What is the InChIKey of 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one?
The InChIKey is HARAMUQUMADASW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H11ClO4S/c13-5-6-17-7-9-8-18(15,16)11-4-2-1-3-10(11)12(9)14/h1-4,8H,5-7H2.
What are the key properties of 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one?
3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one has a molecular weight of 286.74 g/mol, XLogP of 1.80, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-chloroethoxymethyl)-1,1-dioxothiochromen-4-one is sourced from PubChem (CID 12741894), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).