About 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one
3-(hydroxymethyl)-1,1-dioxothiochromen-4-one (PubChem CID 12741905) has the molecular formula C10H8O4S
and a molecular weight of 224.24 g/mol. Its IUPAC name is 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one.
Molecular Properties
| Compound Name | 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one |
| PubChem CID | 12741905 |
| Molecular Formula | C10H8O4S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one |
| SMILES | O=C1C(CO)=CS(=O)(=O)c2ccccc21 |
| InChI | InChI=1S/C10H8O4S/c11-5-7-6-15(13,14)9-4-2-1-3-8(9)10(7)12/h1-4,6,11H,5H2 |
| InChIKey | NQFMISUXVSCHNV-UHFFFAOYSA-N |
| XLogP | 0.53 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one?
The IUPAC name of 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one (CID 12741905) is 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one.
What is the SMILES notation for 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one?
The canonical SMILES for 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one is O=C1C(CO)=CS(=O)(=O)c2ccccc21.
What is the InChIKey of 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one?
The InChIKey is NQFMISUXVSCHNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H8O4S/c11-5-7-6-15(13,14)9-4-2-1-3-8(9)10(7)12/h1-4,6,11H,5H2.
What are the key properties of 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one?
3-(hydroxymethyl)-1,1-dioxothiochromen-4-one has a molecular weight of 224.24 g/mol, XLogP of 0.53, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(hydroxymethyl)-1,1-dioxothiochromen-4-one is sourced from PubChem (CID 12741905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).