About 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile
2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile (PubChem CID 12742087) has the molecular formula C10H7N5S
and a molecular weight of 229.27 g/mol. Its IUPAC name is 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile.
Molecular Properties
| Compound Name | 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile |
| PubChem CID | 12742087 |
| Molecular Formula | C10H7N5S |
| Molecular Weight | 229.27 g/mol |
| Exact Mass | 229.04 |
| IUPAC Name | 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile |
| SMILES | CN(C)c1ncc(C(C#N)=C(C#N)C#N)s1 |
| InChI | InChI=1S/C10H7N5S/c1-15(2)10-14-6-9(16-10)8(5-13)7(3-11)4-12/h6H,1-2H3 |
| InChIKey | FNSNFKDYULOZFM-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 87.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.27 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile?
The IUPAC name of 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile (CID 12742087) is 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile.
What is the SMILES notation for 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile?
The canonical SMILES for 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile is CN(C)c1ncc(C(C#N)=C(C#N)C#N)s1.
What is the InChIKey of 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile?
The InChIKey is FNSNFKDYULOZFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N5S/c1-15(2)10-14-6-9(16-10)8(5-13)7(3-11)4-12/h6H,1-2H3.
What are the key properties of 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile?
2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile has a molecular weight of 229.27 g/mol, XLogP of 1.53, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(dimethylamino)-1,3-thiazol-5-yl]ethene-1,1,2-tricarbonitrile is sourced from PubChem (CID 12742087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).