C10H13NO2 — CID 12742313
3-methyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione (PubChem CID 12742313) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is 3-methyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione.
| Compound Name | 3-methyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
|---|---|
| PubChem CID | 12742313 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | 3-methyl-1,3,4,6,7,8-hexahydroquinoline-2,5-dione |
| SMILES | CC1CC2=C(CCCC2=O)NC1=O |
| InChI | InChI=1S/C10H13NO2/c1-6-5-7-8(11-10(6)13)3-2-4-9(7)12/h6H,2-5H2,1H3,(H,11,13) |
| InChIKey | FLMLEBLKNYPOER-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |