About 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine
9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine (PubChem CID 1274258) has the molecular formula C15H11N3O
and a molecular weight of 249.27 g/mol. Its IUPAC name is 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine.
Molecular Properties
| Compound Name | 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine |
| PubChem CID | 1274258 |
| Molecular Formula | C15H11N3O |
| Molecular Weight | 249.27 g/mol |
| Exact Mass | 249.09 |
| IUPAC Name | 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine |
| SMILES | [H]/N=c1\c2ccccc2nc2oc3ccc(C)cc3n12 |
| InChI | InChI=1S/C15H11N3O/c1-9-6-7-13-12(8-9)18-14(16)10-4-2-3-5-11(10)17-15(18)19-13/h2-8,16H,1H3/b16-14+ |
| InChIKey | ZAKMSVGKSKZQAI-JQIJEIRASA-N |
| XLogP | 3.02 |
| TPSA | 54.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.27 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine?
The IUPAC name of 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine (CID 1274258) is 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine.
What is the SMILES notation for 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine?
The canonical SMILES for 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine is [H]/N=c1\c2ccccc2nc2oc3ccc(C)cc3n12.
What is the InChIKey of 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine?
The InChIKey is ZAKMSVGKSKZQAI-JQIJEIRASA-N. The full InChI is InChI=1S/C15H11N3O/c1-9-6-7-13-12(8-9)18-14(16)10-4-2-3-5-11(10)17-15(18)19-13/h2-8,16H,1H3/b16-14+.
What are the key properties of 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine?
9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine has a molecular weight of 249.27 g/mol, XLogP of 3.02, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 9-methyl-[1,3]benzoxazolo[2,3-b]quinazolin-12-imine is sourced from PubChem (CID 1274258), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).