About 2-aminohexan-3-one
2-aminohexan-3-one (PubChem CID 12742672) has the molecular formula C6H13NO
and a molecular weight of 115.18 g/mol. Its IUPAC name is 2-aminohexan-3-one.
Molecular Properties
| Compound Name | 2-aminohexan-3-one |
| PubChem CID | 12742672 |
| Molecular Formula | C6H13NO |
| Molecular Weight | 115.18 g/mol |
| Exact Mass | 115.10 |
| IUPAC Name | 2-aminohexan-3-one |
| SMILES | CCCC(=O)C(C)N |
| InChI | InChI=1S/C6H13NO/c1-3-4-6(8)5(2)7/h5H,3-4,7H2,1-2H3 |
| InChIKey | UEZMUEILZJTWQH-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 115.18 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminohexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminohexan-3-one?
The IUPAC name of 2-aminohexan-3-one (CID 12742672) is 2-aminohexan-3-one.
What is the SMILES notation for 2-aminohexan-3-one?
The canonical SMILES for 2-aminohexan-3-one is CCCC(=O)C(C)N.
What is the InChIKey of 2-aminohexan-3-one?
The InChIKey is UEZMUEILZJTWQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H13NO/c1-3-4-6(8)5(2)7/h5H,3-4,7H2,1-2H3.
What are the key properties of 2-aminohexan-3-one?
2-aminohexan-3-one has a molecular weight of 115.18 g/mol, XLogP of 0.70, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminohexan-3-one is sourced from PubChem (CID 12742672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).