About 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole
2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole (PubChem CID 12742686) has the molecular formula C20H20N2
and a molecular weight of 288.39 g/mol. Its IUPAC name is 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole.
Molecular Properties
| Compound Name | 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole |
| PubChem CID | 12742686 |
| Molecular Formula | C20H20N2 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.16 |
| IUPAC Name | 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole |
| SMILES | Cc1c(-c2c(C)c3ccccc3n2C)n(C)c2ccccc12 |
| InChI | InChI=1S/C20H20N2/c1-13-15-9-5-7-11-17(15)21(3)19(13)20-14(2)16-10-6-8-12-18(16)22(20)4/h5-12H,1-4H3 |
| InChIKey | AUMRRQTUJFMFSV-UHFFFAOYSA-N |
| XLogP | 4.95 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 4.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|
Analyze 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole?
The IUPAC name of 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole (CID 12742686) is 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole.
What is the SMILES notation for 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole?
The canonical SMILES for 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole is Cc1c(-c2c(C)c3ccccc3n2C)n(C)c2ccccc12.
What is the InChIKey of 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole?
The InChIKey is AUMRRQTUJFMFSV-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H20N2/c1-13-15-9-5-7-11-17(15)21(3)19(13)20-14(2)16-10-6-8-12-18(16)22(20)4/h5-12H,1-4H3.
What are the key properties of 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole?
2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole has a molecular weight of 288.39 g/mol, XLogP of 4.95, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,3-dimethylindol-2-yl)-1,3-dimethylindole is sourced from PubChem (CID 12742686), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).