C12H18 — CID 12742755
4-propan-2-yl-2,3,3a,7a-tetrahydro-1H-indene (PubChem CID 12742755) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is 4-propan-2-yl-2,3,3a,7a-tetrahydro-1H-indene.
| Compound Name | 4-propan-2-yl-2,3,3a,7a-tetrahydro-1H-indene |
|---|---|
| PubChem CID | 12742755 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | 4-propan-2-yl-2,3,3a,7a-tetrahydro-1H-indene |
| SMILES | CC(C)C1=CC=CC2CCCC12 |
| InChI | InChI=1S/C12H18/c1-9(2)11-7-3-5-10-6-4-8-12(10)11/h3,5,7,9-10,12H,4,6,8H2,1-2H3 |
| InChIKey | BHHLUTJBCGPXTM-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |