C17H19N — CID 12743117
1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline (PubChem CID 12743117) has the molecular formula C17H19N and a molecular weight of 237.35 g/mol. Its IUPAC name is 1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline.
| Compound Name | 1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline |
|---|---|
| PubChem CID | 12743117 |
| Molecular Formula | C17H19N |
| Molecular Weight | 237.35 g/mol |
| Exact Mass | 237.15 |
| IUPAC Name | 1-(2-phenylethyl)-1,2,3,4-tetrahydroisoquinoline |
| SMILES | c1ccc(CCC2NCCc3ccccc32)cc1 |
| InChI | InChI=1S/C17H19N/c1-2-6-14(7-3-1)10-11-17-16-9-5-4-8-15(16)12-13-18-17/h1-9,17-18H,10-13H2 |
| InChIKey | UKUJIVVXTYWNIO-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.35 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |